The Biofilms Structural Database
|
|
The Biofilms Structural Database |
Autoinducer-2 |
|
|---|---|
1TJY |
|
Code
PAV | |
|
Name |
(2R,4S)-2-methyl-2,3,3,4-tetrahydroxytetrahydrofuran |
|
Molecular Weight |
150.13 |
|
Isomeric SMILES |
C[C@@]1(O)OC[C@H](O)C1(O)O |
|
Formula |
C5H10O5 |
|
Identifiers |
(2R,4S)-2-methyloxolane-2,3,3,4-tetrol |
|
Formal Charge |
0 |
|
InChI |
InChI=1S/C5H10O5/c1-4(7)5(8,9)3(6)2-10-4/h3,6-9H,2H2,1H3/t3-,4+/m0/s1 |
|
Atom Count |
20 |
|
InChIKey |
BVIYGXUQVXBHQS-IUYQGCFVSA-N |
|
PDB codes |
1TJY, 3T95 |
|
Type |
Non-polymer |
|
Chiral Atom Count |
1 |
|
Chiral Atoms |
C4, C7 |
|
Bond Count |
20 |
|
Aromatic Bond Count |
0 |
|
Leaving Atoms |
n/a |