The Biofilms Structural Database
|
|
The Biofilms Structural Database |
phospho-Autoinducer-2 |
|
|---|---|
4L4Z |
|
Code
D5X | |
|
Name |
(2S)-2,3,3-trihydroxy-4-oxopentyl dihydrogen phosphate |
|
Molecular Weight |
230.11 |
|
Isomeric SMILES |
CC(=O)C(O)(O)[C@@H](O)COP(O)(O)=O |
|
Formula |
C5H11O8P |
|
Identifiers |
[(2S)-2,3,3-tris(oxidanyl)-4-oxidanylidene-pentyl] dihydrogen phosphate |
|
Formal Charge |
0 |
|
InChI |
InChI=1S/C5H11O8P/c1-3(6)5(8,9)4(7)2-13-14(10,11)12/h4,7-9H,2H2,1H3,(H2,10,11,12)/t4-/m0/s1 |
|
Atom Count |
25 |
|
InChIKey |
FWCIRYJUXQBEHG-BYPYZUCNSA-N |
|
PDB codes |
4L4Z |
|
Type |
Non-polymer |
|
Chiral Atom Count |
1 |
|
Chiral Atoms |
C4 |
|
Bond Count |
24 |
|
Aromatic Bond Count |
0 |
|
Leaving Atoms |
n/a |